C11H23N — CID 105049433
1-cyclobutyl-N,2,3-trimethylbutan-1-amine (PubChem CID 105049433) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-cyclobutyl-N,2,3-trimethylbutan-1-amine.
| Compound Name | 1-cyclobutyl-N,2,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 105049433 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-cyclobutyl-N,2,3-trimethylbutan-1-amine |
| SMILES | CNC(C1CCC1)C(C)C(C)C |
| InChI | InChI=1S/C11H23N/c1-8(2)9(3)11(12-4)10-6-5-7-10/h8-12H,5-7H2,1-4H3 |
| InChIKey | HRJSRRCIIYXOSB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |