C10H22N2 — CID 116948168
1-cyclohexyl-1-N-methylpropane-1,2-diamine (PubChem CID 116948168) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-cyclohexyl-1-N-methylpropane-1,2-diamine.
| Compound Name | 1-cyclohexyl-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 116948168 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-cyclohexyl-1-N-methylpropane-1,2-diamine |
| SMILES | CNC(C(C)N)C1CCCCC1 |
| InChI | InChI=1S/C10H22N2/c1-8(11)10(12-2)9-6-4-3-5-7-9/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | FWNWZEOMGPTFFI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |