C9H17F2N — CID 80606050
1-cyclohexyl-2,2-difluoro-N-methylethanamine (PubChem CID 80606050) has the molecular formula C9H17F2N and a molecular weight of 177.24 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-difluoro-N-methylethanamine.
| Compound Name | 1-cyclohexyl-2,2-difluoro-N-methylethanamine |
|---|---|
| PubChem CID | 80606050 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-cyclohexyl-2,2-difluoro-N-methylethanamine |
| SMILES | CNC(C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C9H17F2N/c1-12-8(9(10)11)7-5-3-2-4-6-7/h7-9,12H,2-6H2,1H3 |
| InChIKey | DYFSLCVDOCOENT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |