C13H20FN — CID 79446365
2-(3-fluorophenyl)-N,3-dimethylpentan-1-amine (PubChem CID 79446365) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 2-(3-fluorophenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 79446365 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-(3-fluorophenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)C(CNC)c1cccc(F)c1 |
| InChI | InChI=1S/C13H20FN/c1-4-10(2)13(9-15-3)11-6-5-7-12(14)8-11/h5-8,10,13,15H,4,9H2,1-3H3 |
| InChIKey | JOOHMVZTQCLVKB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |