C17H19F2N — CID 22708359
3,3-bis(3-fluorophenyl)-N,2-dimethylpropan-1-amine (PubChem CID 22708359) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is 3,3-bis(3-fluorophenyl)-N,2-dimethylpropan-1-amine.
| Compound Name | 3,3-bis(3-fluorophenyl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 22708359 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3,3-bis(3-fluorophenyl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)C(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H19F2N/c1-12(11-20-2)17(13-5-3-7-15(18)9-13)14-6-4-8-16(19)10-14/h3-10,12,17,20H,11H2,1-2H3 |
| InChIKey | PWAGUZJFUDFXDU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |