C15H16Br3FN2 — CID 79446409
4-bromo-5-[3-bromo-2-(bromomethyl)-2-(4-fluorophenyl)propyl]-1,3-dimethylpyrazole (PubChem CID 79446409) has the molecular formula C15H16Br3FN2 and a molecular weight of 483.02 g/mol. Its IUPAC name is 4-bromo-5-[3-bromo-2-(bromomethyl)-2-(4-fluorophenyl)propyl]-1,3-dimethylpyrazole.
| Compound Name | 4-bromo-5-[3-bromo-2-(bromomethyl)-2-(4-fluorophenyl)propyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 79446409 |
| Molecular Formula | C15H16Br3FN2 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 479.88 |
| IUPAC Name | 4-bromo-5-[3-bromo-2-(bromomethyl)-2-(4-fluorophenyl)propyl]-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(CC(CBr)(CBr)c2ccc(F)cc2)c1Br |
| InChI | InChI=1S/C15H16Br3FN2/c1-10-14(18)13(21(2)20-10)7-15(8-16,9-17)11-3-5-12(19)6-4-11/h3-6H,7-9H2,1-2H3 |
| InChIKey | KIXXNEZDVLSZBO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|