C12H13F2N — CID 79446877
2-(3,5-difluorophenyl)-3-methylpentanenitrile (PubChem CID 79446877) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-3-methylpentanenitrile.
| Compound Name | 2-(3,5-difluorophenyl)-3-methylpentanenitrile |
|---|---|
| PubChem CID | 79446877 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(3,5-difluorophenyl)-3-methylpentanenitrile |
| SMILES | CCC(C)C(C#N)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2N/c1-3-8(2)12(7-15)9-4-10(13)6-11(14)5-9/h4-6,8,12H,3H2,1-2H3 |
| InChIKey | VUTDYNDEBBVKRL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |