C12H22Cl2O — CID 79447508
4-[2,2-bis(chloromethyl)-3-methylbutyl]oxane (PubChem CID 79447508) has the molecular formula C12H22Cl2O and a molecular weight of 253.21 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-3-methylbutyl]oxane.
| Compound Name | 4-[2,2-bis(chloromethyl)-3-methylbutyl]oxane |
|---|---|
| PubChem CID | 79447508 |
| Molecular Formula | C12H22Cl2O |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-3-methylbutyl]oxane |
| SMILES | CC(C)C(CCl)(CCl)CC1CCOCC1 |
| InChI | InChI=1S/C12H22Cl2O/c1-10(2)12(8-13,9-14)7-11-3-5-15-6-4-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | BJJWRPFYAQMERZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|