C13H24Cl2O — CID 79447305
4-[2,2-bis(chloromethyl)-4-methylpentyl]oxane (PubChem CID 79447305) has the molecular formula C13H24Cl2O and a molecular weight of 267.24 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-4-methylpentyl]oxane.
| Compound Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]oxane |
|---|---|
| PubChem CID | 79447305 |
| Molecular Formula | C13H24Cl2O |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]oxane |
| SMILES | CC(C)CC(CCl)(CCl)CC1CCOCC1 |
| InChI | InChI=1S/C13H24Cl2O/c1-11(2)7-13(9-14,10-15)8-12-3-5-16-6-4-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | IEZGZPBMCQSQNS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|