C13H18Cl2 — CID 79447601
[2,2-bis(chloromethyl)-3-methylbutyl]benzene (PubChem CID 79447601) has the molecular formula C13H18Cl2 and a molecular weight of 245.19 g/mol. Its IUPAC name is [2,2-bis(chloromethyl)-3-methylbutyl]benzene.
| Compound Name | [2,2-bis(chloromethyl)-3-methylbutyl]benzene |
|---|---|
| PubChem CID | 79447601 |
| Molecular Formula | C13H18Cl2 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [2,2-bis(chloromethyl)-3-methylbutyl]benzene |
| SMILES | CC(C)C(CCl)(CCl)Cc1ccccc1 |
| InChI | InChI=1S/C13H18Cl2/c1-11(2)13(9-14,10-15)8-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | SJNOTQSOMDYUIU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|