C13H17Cl2F — CID 79447880
1-[2,2-bis(chloromethyl)-3-methylbutyl]-4-fluorobenzene (PubChem CID 79447880) has the molecular formula C13H17Cl2F and a molecular weight of 263.18 g/mol. Its IUPAC name is 1-[2,2-bis(chloromethyl)-3-methylbutyl]-4-fluorobenzene.
| Compound Name | 1-[2,2-bis(chloromethyl)-3-methylbutyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 79447880 |
| Molecular Formula | C13H17Cl2F |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-[2,2-bis(chloromethyl)-3-methylbutyl]-4-fluorobenzene |
| SMILES | CC(C)C(CCl)(CCl)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H17Cl2F/c1-10(2)13(8-14,9-15)7-11-3-5-12(16)6-4-11/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | QMNPAYTVWRYIEU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|