C12H21Cl2N3 — CID 79448052
5-[2,2-bis(chloromethyl)pentyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 79448052) has the molecular formula C12H21Cl2N3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-[2,2-bis(chloromethyl)pentyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-[2,2-bis(chloromethyl)pentyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 79448052 |
| Molecular Formula | C12H21Cl2N3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[2,2-bis(chloromethyl)pentyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CCCC(CCl)(CCl)Cc1ncnn1C(C)C |
| InChI | InChI=1S/C12H21Cl2N3/c1-4-5-12(7-13,8-14)6-11-15-9-16-17(11)10(2)3/h9-10H,4-8H2,1-3H3 |
| InChIKey | JMNYISJRWXSHMV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|