C12H13FN2S — CID 79448591
2-(2-fluorophenyl)-3-(1,3-thiazol-4-yl)propan-1-amine (PubChem CID 79448591) has the molecular formula C12H13FN2S and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-(1,3-thiazol-4-yl)propan-1-amine.
| Compound Name | 2-(2-fluorophenyl)-3-(1,3-thiazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 79448591 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(2-fluorophenyl)-3-(1,3-thiazol-4-yl)propan-1-amine |
| SMILES | NCC(Cc1cscn1)c1ccccc1F |
| InChI | InChI=1S/C12H13FN2S/c13-12-4-2-1-3-11(12)9(6-14)5-10-7-16-8-15-10/h1-4,7-9H,5-6,14H2 |
| InChIKey | OIYPAQGZQQGEKF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |