C12H11ClFNS — CID 79454763
4-[3-chloro-2-(2-fluorophenyl)propyl]-1,3-thiazole (PubChem CID 79454763) has the molecular formula C12H11ClFNS and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-[3-chloro-2-(2-fluorophenyl)propyl]-1,3-thiazole.
| Compound Name | 4-[3-chloro-2-(2-fluorophenyl)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79454763 |
| Molecular Formula | C12H11ClFNS |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-[3-chloro-2-(2-fluorophenyl)propyl]-1,3-thiazole |
| SMILES | Fc1ccccc1C(CCl)Cc1cscn1 |
| InChI | InChI=1S/C12H11ClFNS/c13-6-9(5-10-7-16-8-15-10)11-3-1-2-4-12(11)14/h1-4,7-9H,5-6H2 |
| InChIKey | NXLHMCSCWRVJSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|