C16H24O3 — CID 79450140
2-(2-methylphenyl)-2-[2-(oxolan-2-yl)ethyl]propane-1,3-diol (PubChem CID 79450140) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-(2-methylphenyl)-2-[2-(oxolan-2-yl)ethyl]propane-1,3-diol.
| Compound Name | 2-(2-methylphenyl)-2-[2-(oxolan-2-yl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79450140 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(2-methylphenyl)-2-[2-(oxolan-2-yl)ethyl]propane-1,3-diol |
| SMILES | Cc1ccccc1C(CO)(CO)CCC1CCCO1 |
| InChI | InChI=1S/C16H24O3/c1-13-5-2-3-7-15(13)16(11-17,12-18)9-8-14-6-4-10-19-14/h2-3,5,7,14,17-18H,4,6,8-12H2,1H3 |
| InChIKey | FHQGVHTXXZIJMM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |