C14H19FO3 — CID 79450596
2-(3-fluorophenyl)-2-(oxolan-2-ylmethyl)propane-1,3-diol (PubChem CID 79450596) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-(oxolan-2-ylmethyl)propane-1,3-diol.
| Compound Name | 2-(3-fluorophenyl)-2-(oxolan-2-ylmethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450596 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(3-fluorophenyl)-2-(oxolan-2-ylmethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CC1CCCO1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H19FO3/c15-12-4-1-3-11(7-12)14(9-16,10-17)8-13-5-2-6-18-13/h1,3-4,7,13,16-17H,2,5-6,8-10H2 |
| InChIKey | AJQLREZHGBAJPJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |