C14H16O2S — CID 79450575
2-phenyl-2-(thiophen-2-ylmethyl)propane-1,3-diol (PubChem CID 79450575) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-phenyl-2-(thiophen-2-ylmethyl)propane-1,3-diol.
| Compound Name | 2-phenyl-2-(thiophen-2-ylmethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450575 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-phenyl-2-(thiophen-2-ylmethyl)propane-1,3-diol |
| SMILES | OCC(CO)(Cc1cccs1)c1ccccc1 |
| InChI | InChI=1S/C14H16O2S/c15-10-14(11-16,9-13-7-4-8-17-13)12-5-2-1-3-6-12/h1-8,15-16H,9-11H2 |
| InChIKey | WWCKSJUDFHAUKC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |