C12H16N2O5 — CID 175313364
2-(hydroxymethyl)-2-phenylpropane-1,3-diol;isocyanic acid (PubChem CID 175313364) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-phenylpropane-1,3-diol;isocyanic acid.
| Compound Name | 2-(hydroxymethyl)-2-phenylpropane-1,3-diol;isocyanic acid |
|---|---|
| PubChem CID | 175313364 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(hydroxymethyl)-2-phenylpropane-1,3-diol;isocyanic acid |
| SMILES | N=C=O.N=C=O.OCC(CO)(CO)c1ccccc1 |
| InChI | InChI=1S/C10H14O3.2CHNO/c11-6-10(7-12,8-13)9-4-2-1-3-5-9;2*2-1-3/h1-5,11-13H,6-8H2;2*2H |
| InChIKey | WZJBLFKZWFBEHU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|