C15H24O2S — CID 114271574
2-(2-tert-butylsulfanylethyl)-2-phenylpropane-1,3-diol (PubChem CID 114271574) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 2-(2-tert-butylsulfanylethyl)-2-phenylpropane-1,3-diol.
| Compound Name | 2-(2-tert-butylsulfanylethyl)-2-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 114271574 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-(2-tert-butylsulfanylethyl)-2-phenylpropane-1,3-diol |
| SMILES | CC(C)(C)SCCC(CO)(CO)c1ccccc1 |
| InChI | InChI=1S/C15H24O2S/c1-14(2,3)18-10-9-15(11-16,12-17)13-7-5-4-6-8-13/h4-8,16-17H,9-12H2,1-3H3 |
| InChIKey | YFCCUAUVBLMELL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |