C17H17Cl2N — CID 79451201
3-benzyl-3-[(3,4-dichlorophenyl)methyl]azetidine (PubChem CID 79451201) has the molecular formula C17H17Cl2N and a molecular weight of 306.24 g/mol. Its IUPAC name is 3-benzyl-3-[(3,4-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-benzyl-3-[(3,4-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 79451201 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-benzyl-3-[(3,4-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1ccc(CC2(Cc3ccccc3)CNC2)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N/c18-15-7-6-14(8-16(15)19)10-17(11-20-12-17)9-13-4-2-1-3-5-13/h1-8,20H,9-12H2 |
| InChIKey | FPGJKCIRJBYKKC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |