C16H14Cl3N — CID 79459812
3-(2-chlorophenyl)-3-[(3,4-dichlorophenyl)methyl]azetidine (PubChem CID 79459812) has the molecular formula C16H14Cl3N and a molecular weight of 326.65 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-[(3,4-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-(2-chlorophenyl)-3-[(3,4-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 79459812 |
| Molecular Formula | C16H14Cl3N |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-(2-chlorophenyl)-3-[(3,4-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1ccc(CC2(c3ccccc3Cl)CNC2)cc1Cl |
| InChI | InChI=1S/C16H14Cl3N/c17-13-4-2-1-3-12(13)16(9-20-10-16)8-11-5-6-14(18)15(19)7-11/h1-7,20H,8-10H2 |
| InChIKey | ACZNPDWPSRELCL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |