C18H23N3 — CID 79451339
1-cyclopentyl-3-[(3-phenylazetidin-3-yl)methyl]pyrazole (PubChem CID 79451339) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(3-phenylazetidin-3-yl)methyl]pyrazole.
| Compound Name | 1-cyclopentyl-3-[(3-phenylazetidin-3-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 79451339 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-cyclopentyl-3-[(3-phenylazetidin-3-yl)methyl]pyrazole |
| SMILES | c1ccc(C2(Cc3ccn(C4CCCC4)n3)CNC2)cc1 |
| InChI | InChI=1S/C18H23N3/c1-2-6-15(7-3-1)18(13-19-14-18)12-16-10-11-21(20-16)17-8-4-5-9-17/h1-3,6-7,10-11,17,19H,4-5,8-9,12-14H2 |
| InChIKey | KHFDWXQRXLAVRX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |