About 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide
3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide (PubChem CID 79452117) has the molecular formula C16H21NO3S
and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide |
| PubChem CID | 79452117 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2(CC3Cc4ccccc4O3)CNC2)C1 |
| InChI | InChI=1S/C16H21NO3S/c18-21(19)6-5-13(9-21)16(10-17-11-16)8-14-7-12-3-1-2-4-15(12)20-14/h1-4,13-14,17H,5-11H2 |
| InChIKey | JPKQRQRNAQRCBO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide?
The IUPAC name of 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide (CID 79452117) is 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide is O=S1(=O)CCC(C2(CC3Cc4ccccc4O3)CNC2)C1.
What is the InChIKey of 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide?
The InChIKey is JPKQRQRNAQRCBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3S/c18-21(19)6-5-13(9-21)16(10-17-11-16)8-14-7-12-3-1-2-4-15(12)20-14/h1-4,13-14,17H,5-11H2.
What are the key properties of 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide?
3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide has a molecular weight of 307.41 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,3-dihydro-1-benzofuran-2-ylmethyl)azetidin-3-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 79452117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).