C16H20N2S — CID 79452431
5-[2-(3-benzylazetidin-3-yl)ethyl]-4-methyl-1,3-thiazole (PubChem CID 79452431) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 5-[2-(3-benzylazetidin-3-yl)ethyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[2-(3-benzylazetidin-3-yl)ethyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 79452431 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5-[2-(3-benzylazetidin-3-yl)ethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCC1(Cc2ccccc2)CNC1 |
| InChI | InChI=1S/C16H20N2S/c1-13-15(19-12-18-13)7-8-16(10-17-11-16)9-14-5-3-2-4-6-14/h2-6,12,17H,7-11H2,1H3 |
| InChIKey | IXFMUEHSVZESIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |