C12H18N2O — CID 79452625
2-(azetidin-3-ylmethyl)-4-methoxy-3,5-dimethylpyridine (PubChem CID 79452625) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethyl)-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-(azetidin-3-ylmethyl)-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 79452625 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(azetidin-3-ylmethyl)-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CC2CNC2)c1C |
| InChI | InChI=1S/C12H18N2O/c1-8-5-14-11(4-10-6-13-7-10)9(2)12(8)15-3/h5,10,13H,4,6-7H2,1-3H3 |
| InChIKey | VVIRHRJKBJMVAC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |