C12H17NO2 — CID 115410537
4-methoxy-3,5-dimethyl-2-[2-(oxiran-2-yl)ethyl]pyridine (PubChem CID 115410537) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-2-[2-(oxiran-2-yl)ethyl]pyridine.
| Compound Name | 4-methoxy-3,5-dimethyl-2-[2-(oxiran-2-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 115410537 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-2-[2-(oxiran-2-yl)ethyl]pyridine |
| SMILES | COc1c(C)cnc(CCC2CO2)c1C |
| InChI | InChI=1S/C12H17NO2/c1-8-6-13-11(5-4-10-7-15-10)9(2)12(8)14-3/h6,10H,4-5,7H2,1-3H3 |
| InChIKey | HYYIQWUNXUUWNI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|