C14H16BrClN2 — CID 79454162
5-[3-bromo-2-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole (PubChem CID 79454162) has the molecular formula C14H16BrClN2 and a molecular weight of 327.65 g/mol. Its IUPAC name is 5-[3-bromo-2-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole.
| Compound Name | 5-[3-bromo-2-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 79454162 |
| Molecular Formula | C14H16BrClN2 |
| Molecular Weight | 327.65 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 5-[3-bromo-2-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole |
| SMILES | Cc1cc(CC(CBr)c2ccccc2Cl)n(C)n1 |
| InChI | InChI=1S/C14H16BrClN2/c1-10-7-12(18(2)17-10)8-11(9-15)13-5-3-4-6-14(13)16/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | WPZKERCFLINVQU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|