C15H18Cl2N2 — CID 66050349
5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole (PubChem CID 66050349) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole.
| Compound Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 66050349 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-dimethylpyrazole |
| SMILES | Cc1cc(CC(CCl)Cc2ccccc2Cl)n(C)n1 |
| InChI | InChI=1S/C15H18Cl2N2/c1-11-7-14(19(2)18-11)9-12(10-16)8-13-5-3-4-6-15(13)17/h3-7,12H,8-10H2,1-2H3 |
| InChIKey | QYZPFABPXZYDCR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|