C14H19Br3O — CID 79455463
2-[2,2-bis(bromomethyl)-3-methylbutyl]-4-bromo-1-methoxybenzene (PubChem CID 79455463) has the molecular formula C14H19Br3O and a molecular weight of 443.02 g/mol. Its IUPAC name is 2-[2,2-bis(bromomethyl)-3-methylbutyl]-4-bromo-1-methoxybenzene.
| Compound Name | 2-[2,2-bis(bromomethyl)-3-methylbutyl]-4-bromo-1-methoxybenzene |
|---|---|
| PubChem CID | 79455463 |
| Molecular Formula | C14H19Br3O |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | 2-[2,2-bis(bromomethyl)-3-methylbutyl]-4-bromo-1-methoxybenzene |
| SMILES | COc1ccc(Br)cc1CC(CBr)(CBr)C(C)C |
| InChI | InChI=1S/C14H19Br3O/c1-10(2)14(8-15,9-16)7-11-6-12(17)4-5-13(11)18-3/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | IQOVKLYWAYDCER-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|