C16H22Br2O — CID 79456065
4-[3-bromo-2-(bromomethyl)-2-(3-methylphenyl)propyl]oxane (PubChem CID 79456065) has the molecular formula C16H22Br2O and a molecular weight of 390.16 g/mol. Its IUPAC name is 4-[3-bromo-2-(bromomethyl)-2-(3-methylphenyl)propyl]oxane.
| Compound Name | 4-[3-bromo-2-(bromomethyl)-2-(3-methylphenyl)propyl]oxane |
|---|---|
| PubChem CID | 79456065 |
| Molecular Formula | C16H22Br2O |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 4-[3-bromo-2-(bromomethyl)-2-(3-methylphenyl)propyl]oxane |
| SMILES | Cc1cccc(C(CBr)(CBr)CC2CCOCC2)c1 |
| InChI | InChI=1S/C16H22Br2O/c1-13-3-2-4-15(9-13)16(11-17,12-18)10-14-5-7-19-8-6-14/h2-4,9,14H,5-8,10-12H2,1H3 |
| InChIKey | UWKKBDODFRXCQT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|