C15H22Br2O2 — CID 79456113
1-[3,3-bis(bromomethyl)-4-methylpentoxy]-4-methoxybenzene (PubChem CID 79456113) has the molecular formula C15H22Br2O2 and a molecular weight of 394.15 g/mol. Its IUPAC name is 1-[3,3-bis(bromomethyl)-4-methylpentoxy]-4-methoxybenzene.
| Compound Name | 1-[3,3-bis(bromomethyl)-4-methylpentoxy]-4-methoxybenzene |
|---|---|
| PubChem CID | 79456113 |
| Molecular Formula | C15H22Br2O2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 1-[3,3-bis(bromomethyl)-4-methylpentoxy]-4-methoxybenzene |
| SMILES | COc1ccc(OCCC(CBr)(CBr)C(C)C)cc1 |
| InChI | InChI=1S/C15H22Br2O2/c1-12(2)15(10-16,11-17)8-9-19-14-6-4-13(18-3)5-7-14/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | HFQNTTWTDXMRMS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|