C14H20Br2O — CID 83152114
1-bromo-4-[3-(bromomethyl)-3,4-dimethylpentoxy]benzene (PubChem CID 83152114) has the molecular formula C14H20Br2O and a molecular weight of 364.12 g/mol. Its IUPAC name is 1-bromo-4-[3-(bromomethyl)-3,4-dimethylpentoxy]benzene.
| Compound Name | 1-bromo-4-[3-(bromomethyl)-3,4-dimethylpentoxy]benzene |
|---|---|
| PubChem CID | 83152114 |
| Molecular Formula | C14H20Br2O |
| Molecular Weight | 364.12 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-bromo-4-[3-(bromomethyl)-3,4-dimethylpentoxy]benzene |
| SMILES | CC(C)C(C)(CBr)CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20Br2O/c1-11(2)14(3,10-15)8-9-17-13-6-4-12(16)5-7-13/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | UNXAFDZUDSOOMK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|