C27H25NO3 — CID 7945649
(E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 7945649) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7945649 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (E)-1-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]-3-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)c1ccc(OCC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C27H25NO3/c29-26(17-10-21-8-11-23(12-9-21)22-6-2-1-3-7-22)24-13-15-25(16-14-24)31-20-27(30)28-18-4-5-19-28/h1-3,6-17H,4-5,18-20H2/b17-10+ |
| InChIKey | BRKPQCIYICEKEJ-LICLKQGHSA-N |
| XLogP | 5.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|