C8H14N2O4 — CID 79456951
2-[2-(azetidine-3-carbonylamino)ethoxy]acetic acid (PubChem CID 79456951) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-[2-(azetidine-3-carbonylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(azetidine-3-carbonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 79456951 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[2-(azetidine-3-carbonylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)C1CNC1 |
| InChI | InChI=1S/C8H14N2O4/c11-7(12)5-14-2-1-10-8(13)6-3-9-4-6/h6,9H,1-5H2,(H,10,13)(H,11,12) |
| InChIKey | SYOVFKJTLSASLM-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|