C8H17ClN2O2 — CID 142434678
N-(2-ethoxyethyl)azetidine-3-carboxamide;hydrochloride (PubChem CID 142434678) has the molecular formula C8H17ClN2O2 and a molecular weight of 208.69 g/mol. Its IUPAC name is N-(2-ethoxyethyl)azetidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-ethoxyethyl)azetidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142434678 |
| Molecular Formula | C8H17ClN2O2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-(2-ethoxyethyl)azetidine-3-carboxamide;hydrochloride |
| SMILES | CCOCCNC(=O)C1CNC1.Cl |
| InChI | InChI=1S/C8H16N2O2.ClH/c1-2-12-4-3-10-8(11)7-5-9-6-7;/h7,9H,2-6H2,1H3,(H,10,11);1H |
| InChIKey | QWWNJTDFKOKKSA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|