C15H32N2O4 — CID 154672359
N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-1-propylazetidine-3-carboxamide;molecular hydrogen (PubChem CID 154672359) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-1-propylazetidine-3-carboxamide;molecular hydrogen.
| Compound Name | N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-1-propylazetidine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 154672359 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]-1-propylazetidine-3-carboxamide;molecular hydrogen |
| SMILES | CCCN1CC(C(=O)NCCOCCOCCOCC)C1.[H][H] |
| InChI | InChI=1S/C15H30N2O4.H2/c1-3-6-17-12-14(13-17)15(18)16-5-7-20-10-11-21-9-8-19-4-2;/h14H,3-13H2,1-2H3,(H,16,18);1H |
| InChIKey | HTCTUKADTGRLTA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|