C15H22N2O2 — CID 79458936
1-N-[1-(1,3-benzodioxol-5-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 79458936) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-N-[1-(1,3-benzodioxol-5-yl)ethyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[1-(1,3-benzodioxol-5-yl)ethyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458936 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-N-[1-(1,3-benzodioxol-5-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | CC(NC1CCCC(N)C1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O2/c1-10(17-13-4-2-3-12(16)8-13)11-5-6-14-15(7-11)19-9-18-14/h5-7,10,12-13,17H,2-4,8-9,16H2,1H3 |
| InChIKey | QMJJIOSWYYPPLW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |