C12H17N3O2 — CID 79459238
1-N-(4-nitrophenyl)cyclohexane-1,3-diamine (PubChem CID 79459238) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-N-(4-nitrophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(4-nitrophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459238 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-N-(4-nitrophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C12H17N3O2/c13-9-2-1-3-11(8-9)14-10-4-6-12(7-5-10)15(16)17/h4-7,9,11,14H,1-3,8,13H2 |
| InChIKey | XCDQQJMEHNFPAQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|