C11H22N2O — CID 79461695
3-N-(oxan-4-ylmethyl)cyclopentane-1,3-diamine (PubChem CID 79461695) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-N-(oxan-4-ylmethyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(oxan-4-ylmethyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79461695 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 3-N-(oxan-4-ylmethyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(NCC2CCOCC2)C1 |
| InChI | InChI=1S/C11H22N2O/c12-10-1-2-11(7-10)13-8-9-3-5-14-6-4-9/h9-11,13H,1-8,12H2 |
| InChIKey | LEBHDKZPPCWXDM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |