C14H28N2 — CID 79461789
3-N-[(4-ethylcyclohexyl)methyl]cyclopentane-1,3-diamine (PubChem CID 79461789) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 3-N-[(4-ethylcyclohexyl)methyl]cyclopentane-1,3-diamine.
| Compound Name | 3-N-[(4-ethylcyclohexyl)methyl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79461789 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 3-N-[(4-ethylcyclohexyl)methyl]cyclopentane-1,3-diamine |
| SMILES | CCC1CCC(CNC2CCC(N)C2)CC1 |
| InChI | InChI=1S/C14H28N2/c1-2-11-3-5-12(6-4-11)10-16-14-8-7-13(15)9-14/h11-14,16H,2-10,15H2,1H3 |
| InChIKey | HITORJLTXYVYGQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |