C9H18N2O2 — CID 79462002
methyl (2S)-2-[(3-aminocyclopentyl)amino]propanoate (PubChem CID 79462002) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl (2S)-2-[(3-aminocyclopentyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-aminocyclopentyl)amino]propanoate |
|---|---|
| PubChem CID | 79462002 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | methyl (2S)-2-[(3-aminocyclopentyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC1CCC(N)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-6(9(12)13-2)11-8-4-3-7(10)5-8/h6-8,11H,3-5,10H2,1-2H3/t6-,7?,8?/m0/s1 |
| InChIKey | SVQDSSJPODGHLW-KKMMWDRVSA-N |
| XLogP | 0.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |