About 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine
3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine (PubChem CID 79462625) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine |
| PubChem CID | 79462625 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine |
| SMILES | CCOc1ncccc1NC1CCC(N)C1 |
| InChI | InChI=1S/C12H19N3O/c1-2-16-12-11(4-3-7-14-12)15-10-6-5-9(13)8-10/h3-4,7,9-10,15H,2,5-6,8,13H2,1H3 |
| InChIKey | QAHKIIQLGUNIDA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine?
The IUPAC name of 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine (CID 79462625) is 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine.
What is the SMILES notation for 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine?
The canonical SMILES for 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine is CCOc1ncccc1NC1CCC(N)C1.
What is the InChIKey of 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine?
The InChIKey is QAHKIIQLGUNIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-2-16-12-11(4-3-7-14-12)15-10-6-5-9(13)8-10/h3-4,7,9-10,15H,2,5-6,8,13H2,1H3.
What are the key properties of 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine?
3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine has a molecular weight of 221.30 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-ethoxy-3-pyridinyl)cyclopentane-1,3-diamine is sourced from PubChem (CID 79462625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).