C13H21N3O — CID 113370712
4-N-(3-ethoxy-2-pyridinyl)cyclohexane-1,4-diamine (PubChem CID 113370712) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-N-(3-ethoxy-2-pyridinyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(3-ethoxy-2-pyridinyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 113370712 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 4-N-(3-ethoxy-2-pyridinyl)cyclohexane-1,4-diamine |
| SMILES | CCOc1cccnc1NC1CCC(N)CC1 |
| InChI | InChI=1S/C13H21N3O/c1-2-17-12-4-3-9-15-13(12)16-11-7-5-10(14)6-8-11/h3-4,9-11H,2,5-8,14H2,1H3,(H,15,16) |
| InChIKey | MENUATGKWWZJOD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |