C11H11BrF2N2O4 — CID 79464283
2-[2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]ethoxy]acetic acid (PubChem CID 79464283) has the molecular formula C11H11BrF2N2O4 and a molecular weight of 353.12 g/mol. Its IUPAC name is 2-[2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79464283 |
| Molecular Formula | C11H11BrF2N2O4 |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-[2-[(2-bromo-4,6-difluorophenyl)carbamoylamino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H11BrF2N2O4/c12-7-3-6(13)4-8(14)10(7)16-11(19)15-1-2-20-5-9(17)18/h3-4H,1-2,5H2,(H,17,18)(H2,15,16,19) |
| InChIKey | BYWSSWAZCFGLGW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|