C20H19NO5 — CID 7946613
(E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-1-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 7946613) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-1-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7946613 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]-1-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | CCOc1cc2c(cc1/C=C/C(=O)c1cccc([N+](=O)[O-])c1)O[C@@H](C)C2 |
| InChI | InChI=1S/C20H19NO5/c1-3-25-19-12-16-9-13(2)26-20(16)11-15(19)7-8-18(22)14-5-4-6-17(10-14)21(23)24/h4-8,10-13H,3,9H2,1-2H3/b8-7+/t13-/m0/s1 |
| InChIKey | JKWBHLZFRVHDED-GWJCSSMESA-N |
| XLogP | 4.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|