C13H17N3S — CID 79470815
2-(aminomethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-4-amine (PubChem CID 79470815) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 2-(aminomethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-4-amine.
| Compound Name | 2-(aminomethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 79470815 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(aminomethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-4-amine |
| SMILES | CN(CCc1cccs1)c1ccnc(CN)c1 |
| InChI | InChI=1S/C13H17N3S/c1-16(7-5-13-3-2-8-17-13)12-4-6-15-11(9-12)10-14/h2-4,6,8-9H,5,7,10,14H2,1H3 |
| InChIKey | RLRFAAQBMCNSKB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |