C14H19N3S — CID 83127479
6-(1-aminoethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-3-amine (PubChem CID 83127479) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 6-(1-aminoethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-3-amine.
| Compound Name | 6-(1-aminoethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 83127479 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 6-(1-aminoethyl)-N-methyl-N-(2-thiophen-2-ylethyl)pyridin-3-amine |
| SMILES | CC(N)c1ccc(N(C)CCc2cccs2)cn1 |
| InChI | InChI=1S/C14H19N3S/c1-11(15)14-6-5-12(10-16-14)17(2)8-7-13-4-3-9-18-13/h3-6,9-11H,7-8,15H2,1-2H3 |
| InChIKey | NRTWPORWPXZMCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |