C12H21N3O2 — CID 79472529
ethyl 2-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)pentanoate (PubChem CID 79472529) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is ethyl 2-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)pentanoate.
| Compound Name | ethyl 2-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)pentanoate |
|---|---|
| PubChem CID | 79472529 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | ethyl 2-(5-ethyl-2-methyl-1,2,4-triazol-3-yl)pentanoate |
| SMILES | CCCC(C(=O)OCC)c1nc(CC)nn1C |
| InChI | InChI=1S/C12H21N3O2/c1-5-8-9(12(16)17-7-3)11-13-10(6-2)14-15(11)4/h9H,5-8H2,1-4H3 |
| InChIKey | HCKOHQNYBHZZOE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |