C10H17N3O2 — CID 79471464
ethyl 2-(2,5-dimethyl-1,2,4-triazol-3-yl)butanoate (PubChem CID 79471464) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethyl-1,2,4-triazol-3-yl)butanoate.
| Compound Name | ethyl 2-(2,5-dimethyl-1,2,4-triazol-3-yl)butanoate |
|---|---|
| PubChem CID | 79471464 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 2-(2,5-dimethyl-1,2,4-triazol-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC)c1nc(C)nn1C |
| InChI | InChI=1S/C10H17N3O2/c1-5-8(10(14)15-6-2)9-11-7(3)12-13(9)4/h8H,5-6H2,1-4H3 |
| InChIKey | RSFGSVNXGFWHLL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |