C11H22N4 — CID 65284962
6-(2,5-dimethyl-1,2,4-triazol-3-yl)heptan-2-amine (PubChem CID 65284962) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 6-(2,5-dimethyl-1,2,4-triazol-3-yl)heptan-2-amine.
| Compound Name | 6-(2,5-dimethyl-1,2,4-triazol-3-yl)heptan-2-amine |
|---|---|
| PubChem CID | 65284962 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 6-(2,5-dimethyl-1,2,4-triazol-3-yl)heptan-2-amine |
| SMILES | Cc1nc(C(C)CCCC(C)N)n(C)n1 |
| InChI | InChI=1S/C11H22N4/c1-8(6-5-7-9(2)12)11-13-10(3)14-15(11)4/h8-9H,5-7,12H2,1-4H3 |
| InChIKey | VXWNYNWQDLUAEA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |